Compound 1918
Identifiers
- Canonical SMILES:
c1ccccc1c1ccccc1
- InChi:
InChI=1S/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H
- InChiKey:
ZUOUZKKEUPVFJK-UHFFFAOYSA-N
External links
7095 |
CHEMBL14092 |
BNL |
External search
Bibliography (1)
Publication | Name |
---|---|
Rickenbacher U, McKinney JD, Oatley SJ, Blake CC. . Structurally specific binding of halogenated biphenyls to thyroxine transport protein. Journal of medicinal chemistry. | biphenyl |
Pharmacological data
Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|
0 | 0 | 0 | 0 |
Targets
PPI family | Best activity | Diseases | MMoA |
---|
Physicochemical filters
Descriptor | Lipinski's RO5 | Veber | Pfizer's 3/75 | |
---|---|---|---|---|
Compliance | ||||
MW | not available | |||
HBA | not available | |||
HBD | not available | |||
HBA + HBD | not available | |||
AlogP | not available | |||
TPSA | not available | |||
RB | not available |
Radar chart
Compound properties unavailable
PCA : iPPI-DB chemical space
PCA : Correlation circle
Efficiencies: iPPI-DB biplot LE versus LLE
Summary
Bibliographic ressources | Biochemical tests | Cellular tests | PK tests | Cytotoxicity tests |
---|---|---|---|---|
1 | 0 | 0 | 0 | 0 |
Pharmacological data
Bibliography | Name | Target | Competition | Assay type | Assay name | Cell line | Activity type | Activity |
---|
Ta | Structure | Name | Drugbank ID |
---|---|---|---|
0.9000 | p-Quaterphenyl | DB12794 | |
0.6667 | Toluene | DB11558 | |
0.6000 | 1-biphenyl-2-ylmethanamine | DB07412 | |
0.5806 | 3,4-Biphenyldiol | DB07478 | |
0.5806 | 4,4'-Biphenyldiboronic Acid | DB02627 | |
0.5454 | Biphenyl-2,3-Diol | DB02923 | |
0.5294 | P-nitrobiphenyl | DB12300 | |
0.5000 | Benzyl alcohol | DB06770 | |
0.5000 | 1-CHLORO-6-(4-HYDROXYPHENYL)-2-NAPHTHOL | DB07119 | |
0.5000 | Benzylamine | DB02464 | |
0.4800 | P-Cresol | DB01688 | |
0.4737 | 3,5-dibromobiphenyl-4-ol | DB08102 | |
0.4737 | Biphenyl dimethyl dicarboxylate | DB12475 | |
0.4615 | Felbinac | DB07477 | |
0.4615 | M-Cresol | DB01776 |